![[3-[(3,5-dimethoxyphenyl)methoxy]phenyl]boronic acid (CAS: 870718-09-5) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0762436.webp "[3-[(3,5-dimethoxyphenyl)methoxy]phenyl]boronic acid chemical structure")
[3-[(3,5-dimethoxyphenyl)methoxy]phenyl]boronic acid
Catalog No: FT-0762436
CAS No: 870718-09-5
- Chemical Name: [3-[(3,5-dimethoxyphenyl)methoxy]phenyl]boronic acid
- Molecular Formula: C15H17BO5
- Molecular Weight: 288.11 g/mol
- InChI Key: AJLNRXRMGFVLDN-UHFFFAOYSA-N
- InChI: InChI=1S/C15H17BO5/c1-19-14-6-11(7-15(9-14)20-2)10-21-13-5-3-4-12(8-13)16(17)18/h3-9,17-18H,10H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 870718-09-5 |
|---|---|
| MF: | C15H17BO5 |
| Density: | 1.23g/cm3 |
| Flash_Point: | 256.1ºC |
| Melting_Point: | 100-105ºC(lit.) |
| Product_Name: | [3-[(3,5-dimethoxyphenyl)methoxy]phenyl]boronic acid |
| Symbol: | GHS07 |
| Bolling_Point: | 499.8ºC at 760 mmHg |
| FW: | 288.10300 |
| Density: | 1.23g/cm3 |
|---|---|
| MF: | C15H17BO5 |
| LogP: | 0.96260 |
| Melting_Point: | 100-105ºC(lit.) |
| Exact_Mass: | 288.11700 |
| Bolling_Point: | 499.8ºC at 760 mmHg |
| Flash_Point: | 256.1ºC |
| FW: | 288.10300 |
| Refractive_Index: | 1.573 |
| PSA: | 68.15000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | 26-36/37 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Hazard_Codes: | Xn: Harmful; |
| HS_Code: | 2931900090 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | 20/21/22-36/37/38 |
